Tetraethylphosphorodiamidic chloride
tetraethylphosphorodiamidic chloride
CAS: 1794-24-7
Molecular Formula: C8H20ClN2OP
Tetraethylphosphorodiamidic chloride - Names and Identifiers
| Name | tetraethylphosphorodiamidic chloride |
| Synonyms | BIS-(DIETHYLAMINO)PHOSPHOCHLORIDATE Bis(diethylamino)phosphorochloridate BIS(DIETHYLAMINO)PHOSPHOROCHLORIDATE tetraethylphosphorodiamidic chloride Tetraethylphosphorodiamidic chloride Bis(diethylamino)phosphoryl chloride Tetraethylphosphorodiamidoyl Chloride Bis(diethylamino)phosphoryl chloride, bis(diethylamino)phosphoryl chloridate Bis(diethylamino)chlorophosphine oxide N,N,N',N'-tetraethylphosphorodiamidic chloride N,N,N',N'-Tetraethyldiamidophosphoric acidchloride N,N'-[(chlorooxy)phosphanediyl]bis(N-ethylethanamine) |
| CAS | 1794-24-7 |
| EINECS | 217-262-9 |
| InChI | InChI=1/C8H20ClN2OP/c1-5-10(6-2)13(12-9)11(7-3)8-4/h5-8H2,1-4H3 |
Tetraethylphosphorodiamidic chloride - Physico-chemical Properties
| Molecular Formula | C8H20ClN2OP |
| Molar Mass | 226.68 |
| Density | 1.07 |
| Boling Point | 101 °C (0.3 mmHg) |
| Flash Point | 101°C/0.3mm |
| Vapor Presure | 0.0396mmHg at 25°C |
| Storage Condition | 0-6°C |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.466-1.468 |
Tetraethylphosphorodiamidic chloride - Risk and Safety
| Hazard Symbols | C - Corrosive |
| Risk Codes | 34 - Causes burns |
| Safety Description | S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 1759 |
| HS Code | 29211999 |
| Hazard Class | 8 |
| Packing Group | II |
Tetraethylphosphorodiamidic chloride - Introduction
(Abbreviated DEAPC) is an organophosphorus compound. The following is an introduction to its nature, use, formulation and safety information:
Nature:
1. Appearance: colorless or light yellow liquid.
2. Molecular formula: C6H16ClNO2P.
3. Melting Point:-42 ℃.
4. Boiling point: 160-165 ℃.
5. Solubility: Soluble in water, alcohol and ketone.
Use:
1. DEAPC is an effective corrosion inhibitor, which can be used in metal anti-rust coatings to extend the service life of metals.
2. It can also be used as a catalyst in organic synthesis to participate in different types of reactions, such as Ester addition reactions.
Method:
The synthesis method of DEAPC is relatively simple and can usually be carried out through the following steps:
1. REACTION: combining amino diethyl alcohol with chloric acid to generate N,N-diethylamino chlorate.
2. Sintering N,N-diethylamino chlorate: sintering reaction occurs under the action of phosphorus chemical agent to generate chloride.
Safety Information:
1. DEAPC should be used in a well-ventilated place to avoid inhaling harmful gases.
2. Contact with skin or eyes, should immediately rinse with water for more than 15 minutes, and consult a doctor.
3. Avoid contact with strong oxidants and strong acids to prevent dangerous reactions.
4. Storage should be sealed and placed in a cool, dry place, away from fire and heat sources.
Please note that the use and handling of chemical substances should follow the relevant safety procedures. Follow proper laboratory practices and personal protective measures when using and handling DEAPC.
Nature:
1. Appearance: colorless or light yellow liquid.
2. Molecular formula: C6H16ClNO2P.
3. Melting Point:-42 ℃.
4. Boiling point: 160-165 ℃.
5. Solubility: Soluble in water, alcohol and ketone.
Use:
1. DEAPC is an effective corrosion inhibitor, which can be used in metal anti-rust coatings to extend the service life of metals.
2. It can also be used as a catalyst in organic synthesis to participate in different types of reactions, such as Ester addition reactions.
Method:
The synthesis method of DEAPC is relatively simple and can usually be carried out through the following steps:
1. REACTION: combining amino diethyl alcohol with chloric acid to generate N,N-diethylamino chlorate.
2. Sintering N,N-diethylamino chlorate: sintering reaction occurs under the action of phosphorus chemical agent to generate chloride.
Safety Information:
1. DEAPC should be used in a well-ventilated place to avoid inhaling harmful gases.
2. Contact with skin or eyes, should immediately rinse with water for more than 15 minutes, and consult a doctor.
3. Avoid contact with strong oxidants and strong acids to prevent dangerous reactions.
4. Storage should be sealed and placed in a cool, dry place, away from fire and heat sources.
Please note that the use and handling of chemical substances should follow the relevant safety procedures. Follow proper laboratory practices and personal protective measures when using and handling DEAPC.
Last Update：2024-04-10 22:29:15
